C10H16ClNO3 — CID 164660397
chloromethyl 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (PubChem CID 164660397) has the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. Its IUPAC name is chloromethyl 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate.
| Compound Name | chloromethyl 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 164660397 |
| Molecular Formula | C10H16ClNO3 |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | chloromethyl 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| SMILES | O=C(OCCl)N1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C10H16ClNO3/c11-6-15-10(14)12-4-7-1-2-9(13)3-8(7)5-12/h7-9,13H,1-6H2 |
| InChIKey | ZNMSWKSCOXMDCZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|