C12H21NO — CID 130941371
2-but-3-enyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 130941371) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-but-3-enyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | 2-but-3-enyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 130941371 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-but-3-enyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | C=CCCN1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C12H21NO/c1-2-3-6-13-8-10-4-5-12(14)7-11(10)9-13/h2,10-12,14H,1,3-9H2 |
| InChIKey | VSLAGIQSVIXKQP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|