About 1-but-3-enyl-1,4-diazepan-6-ol
1-but-3-enyl-1,4-diazepan-6-ol (PubChem CID 130542380) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-but-3-enyl-1,4-diazepan-6-ol.
Molecular Properties
| Compound Name | 1-but-3-enyl-1,4-diazepan-6-ol |
| PubChem CID | 130542380 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-but-3-enyl-1,4-diazepan-6-ol |
| SMILES | C=CCCN1CCNCC(O)C1 |
| InChI | InChI=1S/C9H18N2O/c1-2-3-5-11-6-4-10-7-9(12)8-11/h2,9-10,12H,1,3-8H2 |
| InChIKey | DALOIKCDRGNQAK-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-but-3-enyl-1,4-diazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-3-enyl-1,4-diazepan-6-ol?
The IUPAC name of 1-but-3-enyl-1,4-diazepan-6-ol (CID 130542380) is 1-but-3-enyl-1,4-diazepan-6-ol.
What is the SMILES notation for 1-but-3-enyl-1,4-diazepan-6-ol?
The canonical SMILES for 1-but-3-enyl-1,4-diazepan-6-ol is C=CCCN1CCNCC(O)C1.
What is the InChIKey of 1-but-3-enyl-1,4-diazepan-6-ol?
The InChIKey is DALOIKCDRGNQAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-2-3-5-11-6-4-10-7-9(12)8-11/h2,9-10,12H,1,3-8H2.
What are the key properties of 1-but-3-enyl-1,4-diazepan-6-ol?
1-but-3-enyl-1,4-diazepan-6-ol has a molecular weight of 170.26 g/mol, XLogP of -0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-3-enyl-1,4-diazepan-6-ol is sourced from PubChem (CID 130542380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).