C9H18N2O — CID 130542380
1-but-3-enyl-1,4-diazepan-6-ol (PubChem CID 130542380) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-but-3-enyl-1,4-diazepan-6-ol.
| Compound Name | 1-but-3-enyl-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 130542380 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-but-3-enyl-1,4-diazepan-6-ol |
| SMILES | C=CCCN1CCNCC(O)C1 |
| InChI | InChI=1S/C9H18N2O/c1-2-3-5-11-6-4-10-7-9(12)8-11/h2,9-10,12H,1,3-8H2 |
| InChIKey | DALOIKCDRGNQAK-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|