About 1-(2-methylidenebutyl)-1,4-diazepan-6-ol
1-(2-methylidenebutyl)-1,4-diazepan-6-ol (PubChem CID 130542357) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(2-methylidenebutyl)-1,4-diazepan-6-ol.
Molecular Properties
| Compound Name | 1-(2-methylidenebutyl)-1,4-diazepan-6-ol |
| PubChem CID | 130542357 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-(2-methylidenebutyl)-1,4-diazepan-6-ol |
| SMILES | C=C(CC)CN1CCNCC(O)C1 |
| InChI | InChI=1S/C10H20N2O/c1-3-9(2)7-12-5-4-11-6-10(13)8-12/h10-11,13H,2-8H2,1H3 |
| InChIKey | XMEBKNIXGKFJLA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylidenebutyl)-1,4-diazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylidenebutyl)-1,4-diazepan-6-ol?
The IUPAC name of 1-(2-methylidenebutyl)-1,4-diazepan-6-ol (CID 130542357) is 1-(2-methylidenebutyl)-1,4-diazepan-6-ol.
What is the SMILES notation for 1-(2-methylidenebutyl)-1,4-diazepan-6-ol?
The canonical SMILES for 1-(2-methylidenebutyl)-1,4-diazepan-6-ol is C=C(CC)CN1CCNCC(O)C1.
What is the InChIKey of 1-(2-methylidenebutyl)-1,4-diazepan-6-ol?
The InChIKey is XMEBKNIXGKFJLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-3-9(2)7-12-5-4-11-6-10(13)8-12/h10-11,13H,2-8H2,1H3.
What are the key properties of 1-(2-methylidenebutyl)-1,4-diazepan-6-ol?
1-(2-methylidenebutyl)-1,4-diazepan-6-ol has a molecular weight of 184.28 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylidenebutyl)-1,4-diazepan-6-ol is sourced from PubChem (CID 130542357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).