About 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol
2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol (PubChem CID 126978381) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol.
Molecular Properties
| Compound Name | 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol |
| PubChem CID | 126978381 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol |
| SMILES | C=C(CC)CN1CC(O)CO1 |
| InChI | InChI=1S/C8H15NO2/c1-3-7(2)4-9-5-8(10)6-11-9/h8,10H,2-6H2,1H3 |
| InChIKey | AHRKBTPIOSLGBV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol?
The IUPAC name of 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol (CID 126978381) is 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol.
What is the SMILES notation for 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol?
The canonical SMILES for 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol is C=C(CC)CN1CC(O)CO1.
What is the InChIKey of 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol?
The InChIKey is AHRKBTPIOSLGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-3-7(2)4-9-5-8(10)6-11-9/h8,10H,2-6H2,1H3.
What are the key properties of 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol?
2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol has a molecular weight of 157.21 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylidenebutyl)-1,2-oxazolidin-4-ol is sourced from PubChem (CID 126978381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).