C6H11NO4 — CID 130523459
methyl 2-[(4S)-4-hydroxy-1,2-oxazolidin-2-yl]acetate (PubChem CID 130523459) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is methyl 2-[(4S)-4-hydroxy-1,2-oxazolidin-2-yl]acetate.
| Compound Name | methyl 2-[(4S)-4-hydroxy-1,2-oxazolidin-2-yl]acetate |
|---|---|
| PubChem CID | 130523459 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | methyl 2-[(4S)-4-hydroxy-1,2-oxazolidin-2-yl]acetate |
| SMILES | COC(=O)CN1C[C@H](O)CO1 |
| InChI | InChI=1S/C6H11NO4/c1-10-6(9)3-7-2-5(8)4-11-7/h5,8H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | OMPWBHZKMJFRFI-YFKPBYRVSA-N |
| XLogP | -1.23 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |