C10H18N2O5 — CID 10658068
methyl 2-[(3S,5R)-4-acetamido-3,5-dihydroxypiperidin-1-yl]acetate (PubChem CID 10658068) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is methyl 2-[(3S,5R)-4-acetamido-3,5-dihydroxypiperidin-1-yl]acetate.
| Compound Name | methyl 2-[(3S,5R)-4-acetamido-3,5-dihydroxypiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 10658068 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | methyl 2-[(3S,5R)-4-acetamido-3,5-dihydroxypiperidin-1-yl]acetate |
| SMILES | COC(=O)CN1C[C@@H](O)C(NC(C)=O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H18N2O5/c1-6(13)11-10-7(14)3-12(4-8(10)15)5-9(16)17-2/h7-8,10,14-15H,3-5H2,1-2H3,(H,11,13)/t7-,8+,10? |
| InChIKey | XHGGOCKPPKYJBM-JWHQNHQBSA-N |
| XLogP | -2.30 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |