C10H20N2O2 — CID 126978408
2-(2-piperidin-1-ylethyl)-1,2-oxazolidin-4-ol (PubChem CID 126978408) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylethyl)-1,2-oxazolidin-4-ol.
| Compound Name | 2-(2-piperidin-1-ylethyl)-1,2-oxazolidin-4-ol |
|---|---|
| PubChem CID | 126978408 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-(2-piperidin-1-ylethyl)-1,2-oxazolidin-4-ol |
| SMILES | OC1CON(CCN2CCCCC2)C1 |
| InChI | InChI=1S/C10H20N2O2/c13-10-8-12(14-9-10)7-6-11-4-2-1-3-5-11/h10,13H,1-9H2 |
| InChIKey | WZCFHUCDUITZBG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |