About (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol
(4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol (PubChem CID 130523739) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol.
Molecular Properties
| Compound Name | (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol |
| PubChem CID | 130523739 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol |
| SMILES | O[C@H]1CON(CC2CCOCC2)C1 |
| InChI | InChI=1S/C9H17NO3/c11-9-6-10(13-7-9)5-8-1-3-12-4-2-8/h8-9,11H,1-7H2/t9-/m1/s1 |
| InChIKey | WKQSSCDIDFTWAG-SECBINFHSA-N |
| XLogP | 0.02 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol?
The IUPAC name of (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol (CID 130523739) is (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol.
What is the SMILES notation for (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol?
The canonical SMILES for (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol is O[C@H]1CON(CC2CCOCC2)C1.
What is the InChIKey of (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol?
The InChIKey is WKQSSCDIDFTWAG-SECBINFHSA-N. The full InChI is InChI=1S/C9H17NO3/c11-9-6-10(13-7-9)5-8-1-3-12-4-2-8/h8-9,11H,1-7H2/t9-/m1/s1.
What are the key properties of (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol?
(4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol has a molecular weight of 187.24 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-(oxan-4-ylmethyl)-1,2-oxazolidin-4-ol is sourced from PubChem (CID 130523739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).