About CID 165403949
CID 165403949 (PubChem CID 165403949) has the molecular formula C13H19B4NO
and a molecular weight of 248.55 g/mol.
Molecular Properties
| Compound Name | CID 165403949 |
| PubChem CID | 165403949 |
| Molecular Formula | C13H19B4NO |
| Molecular Weight | 248.55 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CC([B])([B])C2CN(CC3CCOCC3)CC21 |
| InChI | InChI=1S/C13H19B4NO/c14-12(15)8-13(16,17)11-7-18(6-10(11)12)5-9-1-3-19-4-2-9/h9-11H,1-8H2 |
| InChIKey | BPSPETJXYKSWOS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.55 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 165403949 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165403949?
The IUPAC name of CID 165403949 (CID 165403949) is not available.
What is the SMILES notation for CID 165403949?
The canonical SMILES for CID 165403949 is [B]C1([B])CC([B])([B])C2CN(CC3CCOCC3)CC21.
What is the InChIKey of CID 165403949?
The InChIKey is BPSPETJXYKSWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19B4NO/c14-12(15)8-13(16,17)11-7-18(6-10(11)12)5-9-1-3-19-4-2-9/h9-11H,1-8H2.
What are the key properties of CID 165403949?
CID 165403949 has a molecular weight of 248.55 g/mol, XLogP of 0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165403949 is sourced from PubChem (CID 165403949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).