C12H25ClN2O — CID 119923993
3,5-dimethyl-1-(oxan-4-ylmethyl)piperazine;hydrochloride (PubChem CID 119923993) has the molecular formula C12H25ClN2O and a molecular weight of 248.80 g/mol. Its IUPAC name is 3,5-dimethyl-1-(oxan-4-ylmethyl)piperazine;hydrochloride.
| Compound Name | 3,5-dimethyl-1-(oxan-4-ylmethyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 119923993 |
| Molecular Formula | C12H25ClN2O |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 3,5-dimethyl-1-(oxan-4-ylmethyl)piperazine;hydrochloride |
| SMILES | CC1CN(CC2CCOCC2)CC(C)N1.Cl |
| InChI | InChI=1S/C12H24N2O.ClH/c1-10-7-14(8-11(2)13-10)9-12-3-5-15-6-4-12;/h10-13H,3-9H2,1-2H3;1H |
| InChIKey | KOLBVFHEDRDTLR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |