C7H16N2O2 — CID 130523276
2-[2-(dimethylamino)ethyl]-1,2-oxazolidin-4-ol (PubChem CID 130523276) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-1,2-oxazolidin-4-ol.
| Compound Name | 2-[2-(dimethylamino)ethyl]-1,2-oxazolidin-4-ol |
|---|---|
| PubChem CID | 130523276 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-1,2-oxazolidin-4-ol |
| SMILES | CN(C)CCN1CC(O)CO1 |
| InChI | InChI=1S/C7H16N2O2/c1-8(2)3-4-9-5-7(10)6-11-9/h7,10H,3-6H2,1-2H3 |
| InChIKey | RUEHXKHSGNFAOM-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |