C12H17ClN2OS — CID 155953274
2-[(4-chloro-1,3-thiazol-5-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 155953274) has the molecular formula C12H17ClN2OS and a molecular weight of 272.80 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-thiazol-5-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | 2-[(4-chloro-1,3-thiazol-5-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 155953274 |
| Molecular Formula | C12H17ClN2OS |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[(4-chloro-1,3-thiazol-5-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | OC1CCC2CN(Cc3scnc3Cl)CC2C1 |
| InChI | InChI=1S/C12H17ClN2OS/c13-12-11(17-7-14-12)6-15-4-8-1-2-10(16)3-9(8)5-15/h7-10,16H,1-6H2 |
| InChIKey | CHIJNVSSBISJGR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |