C9H12ClNOS — CID 130511552
1-[(3-chlorothiophen-2-yl)methyl]pyrrolidin-3-ol (PubChem CID 130511552) has the molecular formula C9H12ClNOS and a molecular weight of 217.72 g/mol. Its IUPAC name is 1-[(3-chlorothiophen-2-yl)methyl]pyrrolidin-3-ol.
| Compound Name | 1-[(3-chlorothiophen-2-yl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 130511552 |
| Molecular Formula | C9H12ClNOS |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 1-[(3-chlorothiophen-2-yl)methyl]pyrrolidin-3-ol |
| SMILES | OC1CCN(Cc2sccc2Cl)C1 |
| InChI | InChI=1S/C9H12ClNOS/c10-8-2-4-13-9(8)6-11-3-1-7(12)5-11/h2,4,7,12H,1,3,5-6H2 |
| InChIKey | FGRFCACEZVJEHB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |