C9H14Cl2N2S — CID 120833625
1-[(3-chlorothiophen-2-yl)methyl]piperazine;hydrochloride (PubChem CID 120833625) has the molecular formula C9H14Cl2N2S and a molecular weight of 253.20 g/mol. Its IUPAC name is 1-[(3-chlorothiophen-2-yl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(3-chlorothiophen-2-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120833625 |
| Molecular Formula | C9H14Cl2N2S |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 1-[(3-chlorothiophen-2-yl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Clc1ccsc1CN1CCNCC1 |
| InChI | InChI=1S/C9H13ClN2S.ClH/c10-8-1-6-13-9(8)7-12-4-2-11-3-5-12;/h1,6,11H,2-5,7H2;1H |
| InChIKey | GHPAIGOWXQRHHV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |