C11H15BrClNS — CID 131067632
4-bromo-1-[(3-chlorothiophen-2-yl)methyl]azepane (PubChem CID 131067632) has the molecular formula C11H15BrClNS and a molecular weight of 308.67 g/mol. Its IUPAC name is 4-bromo-1-[(3-chlorothiophen-2-yl)methyl]azepane.
| Compound Name | 4-bromo-1-[(3-chlorothiophen-2-yl)methyl]azepane |
|---|---|
| PubChem CID | 131067632 |
| Molecular Formula | C11H15BrClNS |
| Molecular Weight | 308.67 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 4-bromo-1-[(3-chlorothiophen-2-yl)methyl]azepane |
| SMILES | Clc1ccsc1CN1CCCC(Br)CC1 |
| InChI | InChI=1S/C11H15BrClNS/c12-9-2-1-5-14(6-3-9)8-11-10(13)4-7-15-11/h4,7,9H,1-3,5-6,8H2 |
| InChIKey | CXBJPYZAVUXFLT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|