C14H21ClN2OS — CID 100702776
N-[(1S)-1-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-4-yl]ethyl]acetamide (PubChem CID 100702776) has the molecular formula C14H21ClN2OS and a molecular weight of 300.85 g/mol. Its IUPAC name is N-[(1S)-1-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-4-yl]ethyl]acetamide.
| Compound Name | N-[(1S)-1-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 100702776 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-[(1S)-1-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-4-yl]ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)C1CCN(Cc2sccc2Cl)CC1 |
| InChI | InChI=1S/C14H21ClN2OS/c1-10(16-11(2)18)12-3-6-17(7-4-12)9-14-13(15)5-8-19-14/h5,8,10,12H,3-4,6-7,9H2,1-2H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | DGBICOLUUFSUNX-JTQLQIEISA-N |
| XLogP | 3.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |