C16H24ClN3OS — CID 120843136
N-[[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 120843136) has the molecular formula C16H24ClN3OS and a molecular weight of 341.91 g/mol. Its IUPAC name is N-[[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 120843136 |
| Molecular Formula | C16H24ClN3OS |
| Molecular Weight | 341.91 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-[[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC1CCCN(Cc2sccc2Cl)C1)C1CCCN1 |
| InChI | InChI=1S/C16H24ClN3OS/c17-13-5-8-22-15(13)11-20-7-2-3-12(10-20)9-19-16(21)14-4-1-6-18-14/h5,8,12,14,18H,1-4,6-7,9-11H2,(H,19,21) |
| InChIKey | FWGTYJPLFUFZKE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.91 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |