C12H20Cl2N2S — CID 120846233
2-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride (PubChem CID 120846233) has the molecular formula C12H20Cl2N2S and a molecular weight of 295.28 g/mol. Its IUPAC name is 2-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 2-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120846233 |
| Molecular Formula | C12H20Cl2N2S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]ethanamine;hydrochloride |
| SMILES | Cl.NCCC1CCCN(Cc2sccc2Cl)C1 |
| InChI | InChI=1S/C12H19ClN2S.ClH/c13-11-4-7-16-12(11)9-15-6-1-2-10(8-15)3-5-14;/h4,7,10H,1-3,5-6,8-9,14H2;1H |
| InChIKey | KGZAIXTZVOANRN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |