C16H31N3OS — CID 103089534
N-[[1-(4-methylsulfanylbutyl)piperidin-3-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 103089534) has the molecular formula C16H31N3OS and a molecular weight of 313.51 g/mol. Its IUPAC name is N-[[1-(4-methylsulfanylbutyl)piperidin-3-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[[1-(4-methylsulfanylbutyl)piperidin-3-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 103089534 |
| Molecular Formula | C16H31N3OS |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-[[1-(4-methylsulfanylbutyl)piperidin-3-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CSCCCCN1CCCC(CNC(=O)C2CCCN2)C1 |
| InChI | InChI=1S/C16H31N3OS/c1-21-11-3-2-9-19-10-5-6-14(13-19)12-18-16(20)15-7-4-8-17-15/h14-15,17H,2-13H2,1H3,(H,18,20) |
| InChIKey | XHMFRJAMQOPOII-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|