C15H18ClN3O2S — CID 119070014
2-[3-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]pyrazol-1-yl]acetic acid (PubChem CID 119070014) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 2-[3-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 119070014 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-[3-[1-[(3-chlorothiophen-2-yl)methyl]piperidin-3-yl]pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccc(C2CCCN(Cc3sccc3Cl)C2)n1 |
| InChI | InChI=1S/C15H18ClN3O2S/c16-12-4-7-22-14(12)9-18-5-1-2-11(8-18)13-3-6-19(17-13)10-15(20)21/h3-4,6-7,11H,1-2,5,8-10H2,(H,20,21) |
| InChIKey | BRZHEQVIPLLRSC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |