C15H17N3O3S — CID 119071899
2-[3-[1-(thiophene-3-carbonyl)piperidin-3-yl]pyrazol-1-yl]acetic acid (PubChem CID 119071899) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-[3-[1-(thiophene-3-carbonyl)piperidin-3-yl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-[1-(thiophene-3-carbonyl)piperidin-3-yl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 119071899 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[3-[1-(thiophene-3-carbonyl)piperidin-3-yl]pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccc(C2CCCN(C(=O)c3ccsc3)C2)n1 |
| InChI | InChI=1S/C15H17N3O3S/c19-14(20)9-18-6-3-13(16-18)11-2-1-5-17(8-11)15(21)12-4-7-22-10-12/h3-4,6-7,10-11H,1-2,5,8-9H2,(H,19,20) |
| InChIKey | VHEFBXAEIULVHG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |