C17H25N3O3 — CID 126439114
2-[3-[(3S)-1-(cyclohexanecarbonyl)piperidin-3-yl]pyrazol-1-yl]acetic acid (PubChem CID 126439114) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-[3-[(3S)-1-(cyclohexanecarbonyl)piperidin-3-yl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-[(3S)-1-(cyclohexanecarbonyl)piperidin-3-yl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 126439114 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-[3-[(3S)-1-(cyclohexanecarbonyl)piperidin-3-yl]pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccc([C@H]2CCCN(C(=O)C3CCCCC3)C2)n1 |
| InChI | InChI=1S/C17H25N3O3/c21-16(22)12-20-10-8-15(18-20)14-7-4-9-19(11-14)17(23)13-5-2-1-3-6-13/h8,10,13-14H,1-7,9,11-12H2,(H,21,22)/t14-/m0/s1 |
| InChIKey | AIUGBBXTJRTSOT-AWEZNQCLSA-N |
| XLogP | 2.25 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |