C18H23N3O3 — CID 126443440
4-[[(3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]methyl]benzoic acid (PubChem CID 126443440) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-[[(3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 126443440 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-[[(3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2CCC[C@H](c3ccn(CCO)n3)C2)cc1 |
| InChI | InChI=1S/C18H23N3O3/c22-11-10-21-9-7-17(19-21)16-2-1-8-20(13-16)12-14-3-5-15(6-4-14)18(23)24/h3-7,9,16,22H,1-2,8,10-13H2,(H,23,24)/t16-/m0/s1 |
| InChIKey | OJRUTLOGSSWTAW-INIZCTEOSA-N |
| XLogP | 1.95 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |