C19H26N4O2 — CID 126440405
(3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]-N-(2-phenylethyl)piperidine-1-carboxamide (PubChem CID 126440405) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]-N-(2-phenylethyl)piperidine-1-carboxamide.
| Compound Name | (3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]-N-(2-phenylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126440405 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]-N-(2-phenylethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCCc1ccccc1)N1CCC[C@H](c2ccn(CCO)n2)C1 |
| InChI | InChI=1S/C19H26N4O2/c24-14-13-23-12-9-18(21-23)17-7-4-11-22(15-17)19(25)20-10-8-16-5-2-1-3-6-16/h1-3,5-6,9,12,17,24H,4,7-8,10-11,13-15H2,(H,20,25)/t17-/m0/s1 |
| InChIKey | DRWGKQFSJMVMQX-KRWDZBQOSA-N |
| XLogP | 2.01 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |