C21H30N4O2 — CID 126434306
3-[4-(dimethylamino)phenyl]-1-[(3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]propan-1-one (PubChem CID 126434306) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-1-[(3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(dimethylamino)phenyl]-1-[(3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 126434306 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-1-[(3S)-3-[1-(2-hydroxyethyl)pyrazol-3-yl]piperidin-1-yl]propan-1-one |
| SMILES | CN(C)c1ccc(CCC(=O)N2CCC[C@H](c3ccn(CCO)n3)C2)cc1 |
| InChI | InChI=1S/C21H30N4O2/c1-23(2)19-8-5-17(6-9-19)7-10-21(27)24-12-3-4-18(16-24)20-11-13-25(22-20)14-15-26/h5-6,8-9,11,13,18,26H,3-4,7,10,12,14-16H2,1-2H3/t18-/m0/s1 |
| InChIKey | ZXSYTBUVLQGKOD-SFHVURJKSA-N |
| XLogP | 2.28 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|