C21H27N5O — CID 126444321
2-[3-[(3R)-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-3-yl]pyrazol-1-yl]ethanol (PubChem CID 126444321) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-[3-[(3R)-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-3-yl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[3-[(3R)-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-3-yl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 126444321 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 2-[3-[(3R)-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]piperidin-3-yl]pyrazol-1-yl]ethanol |
| SMILES | OCCn1ccc([C@@H]2CCCN(Cc3ccccc3Cn3cccn3)C2)n1 |
| InChI | InChI=1S/C21H27N5O/c27-14-13-25-12-8-21(23-25)20-7-3-10-24(16-20)15-18-5-1-2-6-19(18)17-26-11-4-9-22-26/h1-2,4-6,8-9,11-12,20,27H,3,7,10,13-17H2/t20-/m1/s1 |
| InChIKey | WXXBKMLRYJOTKN-HXUWFJFHSA-N |
| XLogP | 2.50 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |