C17H25N3O2 — CID 126431614
2-[3-[(3S)-1-[3-(furan-2-yl)propyl]piperidin-3-yl]pyrazol-1-yl]ethanol (PubChem CID 126431614) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[3-[(3S)-1-[3-(furan-2-yl)propyl]piperidin-3-yl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[3-[(3S)-1-[3-(furan-2-yl)propyl]piperidin-3-yl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 126431614 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-[3-[(3S)-1-[3-(furan-2-yl)propyl]piperidin-3-yl]pyrazol-1-yl]ethanol |
| SMILES | OCCn1ccc([C@H]2CCCN(CCCc3ccco3)C2)n1 |
| InChI | InChI=1S/C17H25N3O2/c21-12-11-20-10-7-17(18-20)15-4-1-8-19(14-15)9-2-5-16-6-3-13-22-16/h3,6-7,10,13,15,21H,1-2,4-5,8-9,11-12,14H2/t15-/m0/s1 |
| InChIKey | VPALXDDBLIDHQW-HNNXBMFYSA-N |
| XLogP | 2.28 |
| TPSA | 54.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |