C11H18Cl2N2S — CID 120846944
[1-[(3-chlorothiophen-2-yl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120846944) has the molecular formula C11H18Cl2N2S and a molecular weight of 281.25 g/mol. Its IUPAC name is [1-[(3-chlorothiophen-2-yl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[(3-chlorothiophen-2-yl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120846944 |
| Molecular Formula | C11H18Cl2N2S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | [1-[(3-chlorothiophen-2-yl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CC1(CN)CCN(Cc2sccc2Cl)C1.Cl |
| InChI | InChI=1S/C11H17ClN2S.ClH/c1-11(7-13)3-4-14(8-11)6-10-9(12)2-5-15-10;/h2,5H,3-4,6-8,13H2,1H3;1H |
| InChIKey | UJPZMEKXFJIMKQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |