C12H19BrN2S — CID 106318690
1-[1-[(3-bromothiophen-2-yl)methyl]-3-methylpyrrolidin-3-yl]-N-methylmethanamine (PubChem CID 106318690) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is 1-[1-[(3-bromothiophen-2-yl)methyl]-3-methylpyrrolidin-3-yl]-N-methylmethanamine.
| Compound Name | 1-[1-[(3-bromothiophen-2-yl)methyl]-3-methylpyrrolidin-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 106318690 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-[1-[(3-bromothiophen-2-yl)methyl]-3-methylpyrrolidin-3-yl]-N-methylmethanamine |
| SMILES | CNCC1(C)CCN(Cc2sccc2Br)C1 |
| InChI | InChI=1S/C12H19BrN2S/c1-12(8-14-2)4-5-15(9-12)7-11-10(13)3-6-16-11/h3,6,14H,4-5,7-9H2,1-2H3 |
| InChIKey | FYXINFHLRSMEBC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |