C11H14N2S2 — CID 80745758
1-(thieno[3,2-b]thiophen-5-ylmethyl)piperazine (PubChem CID 80745758) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 1-(thieno[3,2-b]thiophen-5-ylmethyl)piperazine.
| Compound Name | 1-(thieno[3,2-b]thiophen-5-ylmethyl)piperazine |
|---|---|
| PubChem CID | 80745758 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-(thieno[3,2-b]thiophen-5-ylmethyl)piperazine |
| SMILES | c1cc2sc(CN3CCNCC3)cc2s1 |
| InChI | InChI=1S/C11H14N2S2/c1-6-14-11-7-9(15-10(1)11)8-13-4-2-12-3-5-13/h1,6-7,12H,2-5,8H2 |
| InChIKey | LKBKKCZZKRAMLR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |