C10H13ClN2O — CID 79031489
(3S)-1-[(3-chloro-4-pyridinyl)methyl]pyrrolidin-3-ol (PubChem CID 79031489) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is (3S)-1-[(3-chloro-4-pyridinyl)methyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[(3-chloro-4-pyridinyl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 79031489 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (3S)-1-[(3-chloro-4-pyridinyl)methyl]pyrrolidin-3-ol |
| SMILES | O[C@H]1CCN(Cc2ccncc2Cl)C1 |
| InChI | InChI=1S/C10H13ClN2O/c11-10-5-12-3-1-8(10)6-13-4-2-9(14)7-13/h1,3,5,9,14H,2,4,6-7H2/t9-/m0/s1 |
| InChIKey | RYHLJGADJOBXIF-VIFPVBQESA-N |
| XLogP | 1.30 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |