C12H16Cl2N2 — CID 114682329
3-chloro-4-[(4-chloro-3-methylpiperidin-1-yl)methyl]pyridine (PubChem CID 114682329) has the molecular formula C12H16Cl2N2 and a molecular weight of 259.18 g/mol. Its IUPAC name is 3-chloro-4-[(4-chloro-3-methylpiperidin-1-yl)methyl]pyridine.
| Compound Name | 3-chloro-4-[(4-chloro-3-methylpiperidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 114682329 |
| Molecular Formula | C12H16Cl2N2 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-chloro-4-[(4-chloro-3-methylpiperidin-1-yl)methyl]pyridine |
| SMILES | CC1CN(Cc2ccncc2Cl)CCC1Cl |
| InChI | InChI=1S/C12H16Cl2N2/c1-9-7-16(5-3-11(9)13)8-10-2-4-15-6-12(10)14/h2,4,6,9,11H,3,5,7-8H2,1H3 |
| InChIKey | SOGISAGILJRSBO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|