C15H29NO — CID 166536916
acetylene;1,4-dimethylcyclohexane;1-ethylazetidin-3-ol (PubChem CID 166536916) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is acetylene;1,4-dimethylcyclohexane;1-ethylazetidin-3-ol.
| Compound Name | acetylene;1,4-dimethylcyclohexane;1-ethylazetidin-3-ol |
|---|---|
| PubChem CID | 166536916 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | acetylene;1,4-dimethylcyclohexane;1-ethylazetidin-3-ol |
| SMILES | C#C.CC1CCC(C)CC1.CCN1CC(O)C1 |
| InChI | InChI=1S/C8H16.C5H11NO.C2H2/c1-7-3-5-8(2)6-4-7;1-2-6-3-5(7)4-6;1-2/h7-8H,3-6H2,1-2H3;5,7H,2-4H2,1H3;1-2H |
| InChIKey | CYJIHMVQYGYFCX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|