C10H18ClN — CID 130804481
5-chloro-2-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 130804481) has the molecular formula C10H18ClN and a molecular weight of 187.71 g/mol. Its IUPAC name is 5-chloro-2-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | 5-chloro-2-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 130804481 |
| Molecular Formula | C10H18ClN |
| Molecular Weight | 187.71 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 5-chloro-2-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CCN1CC2CCC(Cl)CC2C1 |
| InChI | InChI=1S/C10H18ClN/c1-2-12-6-8-3-4-10(11)5-9(8)7-12/h8-10H,2-7H2,1H3 |
| InChIKey | JZDWULHRVCFTNJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.71 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|