C13H24ClN — CID 130987557
5-chloro-2-(2-methylbutyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 130987557) has the molecular formula C13H24ClN and a molecular weight of 229.79 g/mol. Its IUPAC name is 5-chloro-2-(2-methylbutyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | 5-chloro-2-(2-methylbutyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 130987557 |
| Molecular Formula | C13H24ClN |
| Molecular Weight | 229.79 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 5-chloro-2-(2-methylbutyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CCC(C)CN1CC2CCC(Cl)CC2C1 |
| InChI | InChI=1S/C13H24ClN/c1-3-10(2)7-15-8-11-4-5-13(14)6-12(11)9-15/h10-13H,3-9H2,1-2H3 |
| InChIKey | XZHJLMUPQLFTDE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|