C13H25Cl — CID 172615198
(2R)-5-chloro-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;propane (PubChem CID 172615198) has the molecular formula C13H25Cl and a molecular weight of 216.80 g/mol. Its IUPAC name is (2R)-5-chloro-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;propane.
| Compound Name | (2R)-5-chloro-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;propane |
|---|---|
| PubChem CID | 172615198 |
| Molecular Formula | C13H25Cl |
| Molecular Weight | 216.80 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (2R)-5-chloro-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;propane |
| SMILES | CCC.C[C@@H]1CC2CCC(Cl)CC2C1 |
| InChI | InChI=1S/C10H17Cl.C3H8/c1-7-4-8-2-3-10(11)6-9(8)5-7;1-3-2/h7-10H,2-6H2,1H3;3H2,1-2H3/t7-,8?,9?,10?;/m1./s1 |
| InChIKey | IKHHZUJGJRXCDZ-JFDBYUFQSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|