C12H24O — CID 164925413
5-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran;propane (PubChem CID 164925413) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is 5-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran;propane.
| Compound Name | 5-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran;propane |
|---|---|
| PubChem CID | 164925413 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 5-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran;propane |
| SMILES | CC1CCC2COCC2C1.CCC |
| InChI | InChI=1S/C9H16O.C3H8/c1-7-2-3-8-5-10-6-9(8)4-7;1-3-2/h7-9H,2-6H2,1H3;3H2,1-2H3 |
| InChIKey | ZBQOHXQNDRBBMC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |