C9H16O — CID 167189775
(3aS,7aR)-5-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran (PubChem CID 167189775) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (3aS,7aR)-5-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran.
| Compound Name | (3aS,7aR)-5-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran |
|---|---|
| PubChem CID | 167189775 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (3aS,7aR)-5-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran |
| SMILES | CC1CC[C@H]2COC[C@H]2C1 |
| InChI | InChI=1S/C9H16O/c1-7-2-3-8-5-10-6-9(8)4-7/h7-9H,2-6H2,1H3/t7?,8-,9+/m0/s1 |
| InChIKey | BRJPPMRLECAUFX-SXNZSPLWSA-N |
| XLogP | 2.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |