C12H24N2 — CID 130623539
(2R)-1-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)butan-2-amine (PubChem CID 130623539) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (2R)-1-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)butan-2-amine.
| Compound Name | (2R)-1-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 130623539 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (2R)-1-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)butan-2-amine |
| SMILES | CC[C@@H](N)CN1CC2CCCCC2C1 |
| InChI | InChI=1S/C12H24N2/c1-2-12(13)9-14-7-10-5-3-4-6-11(10)8-14/h10-12H,2-9,13H2,1H3/t10?,11?,12-/m1/s1 |
| InChIKey | VWBUKSNMYNITTI-HTAVTVPLSA-N |
| XLogP | 1.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |