C10H17F2N — CID 130628620
2-(2,2-difluoroethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 130628620) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | 2-(2,2-difluoroethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 130628620 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-(2,2-difluoroethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | FC(F)CN1CC2CCCCC2C1 |
| InChI | InChI=1S/C10H17F2N/c11-10(12)7-13-5-8-3-1-2-4-9(8)6-13/h8-10H,1-7H2 |
| InChIKey | LIUUZYXCBIFMQQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |