C6H11F2NO2 — CID 124681434
(3S,4S)-1-(2,2-difluoroethyl)pyrrolidine-3,4-diol (PubChem CID 124681434) has the molecular formula C6H11F2NO2 and a molecular weight of 167.15 g/mol. Its IUPAC name is (3S,4S)-1-(2,2-difluoroethyl)pyrrolidine-3,4-diol.
| Compound Name | (3S,4S)-1-(2,2-difluoroethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 124681434 |
| Molecular Formula | C6H11F2NO2 |
| Molecular Weight | 167.15 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | (3S,4S)-1-(2,2-difluoroethyl)pyrrolidine-3,4-diol |
| SMILES | O[C@H]1CN(CC(F)F)C[C@@H]1O |
| InChI | InChI=1S/C6H11F2NO2/c7-6(8)3-9-1-4(10)5(11)2-9/h4-6,10-11H,1-3H2/t4-,5-/m0/s1 |
| InChIKey | VCHJFTHAYVVEPI-WHFBIAKZSA-N |
| XLogP | -0.71 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.15 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |