C18H36N2O12 — CID 10672109
(3R,4R,5R,6R)-1-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-[(3R,4R,5R,6R)-3,4,5,6-tetrahydroxyazepan-1-yl]hexyl]azepane-3,4,5,6-tetrol (PubChem CID 10672109) has the molecular formula C18H36N2O12 and a molecular weight of 472.49 g/mol. Its IUPAC name is (3R,4R,5R,6R)-1-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-[(3R,4R,5R,6R)-3,4,5,6-tetrahydroxyazepan-1-yl]hexyl]azepane-3,4,5,6-tetrol.
| Compound Name | (3R,4R,5R,6R)-1-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-[(3R,4R,5R,6R)-3,4,5,6-tetrahydroxyazepan-1-yl]hexyl]azepane-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 10672109 |
| Molecular Formula | C18H36N2O12 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (3R,4R,5R,6R)-1-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-[(3R,4R,5R,6R)-3,4,5,6-tetrahydroxyazepan-1-yl]hexyl]azepane-3,4,5,6-tetrol |
| SMILES | O[C@@H]([C@H](O)[C@H](O)CN1C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C1)[C@H](O)CN1C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C18H36N2O12/c21-7-1-19(2-8(22)14(28)13(7)27)5-11(25)17(31)18(32)12(26)6-20-3-9(23)15(29)16(30)10(24)4-20/h7-18,21-32H,1-6H2/t7-,8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | DWAGAOYEALZTTJ-FJWCAOGDSA-N |
| XLogP | -8.05 |
| TPSA | 249.24 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | -8.05 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |