C10H21NO6 — CID 10705883
(2S,3S)-4-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)piperidin-1-yl]butane-1,2,3-triol (PubChem CID 10705883) has the molecular formula C10H21NO6 and a molecular weight of 251.28 g/mol. Its IUPAC name is (2S,3S)-4-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)piperidin-1-yl]butane-1,2,3-triol.
| Compound Name | (2S,3S)-4-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)piperidin-1-yl]butane-1,2,3-triol |
|---|---|
| PubChem CID | 10705883 |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (2S,3S)-4-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)piperidin-1-yl]butane-1,2,3-triol |
| SMILES | OC[C@H]1CN(C[C@H](O)[C@@H](O)CO)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H21NO6/c12-4-6-1-11(3-8(15)10(6)17)2-7(14)9(16)5-13/h6-10,12-17H,1-5H2/t6-,7+,8-,9+,10+/m1/s1 |
| InChIKey | OEJBBIKERILTCU-KGDYZURWSA-N |
| XLogP | -3.65 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |