C14H21NO3 — CID 157039301
1-[(2R)-2-phenylpropyl]piperidine-3,4,5-triol (PubChem CID 157039301) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[(2R)-2-phenylpropyl]piperidine-3,4,5-triol.
| Compound Name | 1-[(2R)-2-phenylpropyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039301 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-[(2R)-2-phenylpropyl]piperidine-3,4,5-triol |
| SMILES | C[C@@H](CN1CC(O)C(O)C(O)C1)c1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c1-10(11-5-3-2-4-6-11)7-15-8-12(16)14(18)13(17)9-15/h2-6,10,12-14,16-18H,7-9H2,1H3/t10-,12?,13?,14?/m0/s1 |
| InChIKey | QTKSLGBKAUOYLT-ZPQSCOJMSA-N |
| XLogP | 0.19 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |