C22H28N2O — CID 126687196
4-[1-[(3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-2-yl]phenol (PubChem CID 126687196) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 4-[1-[(3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-2-yl]phenol.
| Compound Name | 4-[1-[(3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 126687196 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 4-[1-[(3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]propan-2-yl]phenol |
| SMILES | CC(CN1C[C@H]2CN(Cc3ccccc3)C[C@H]2C1)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H28N2O/c1-17(19-7-9-22(25)10-8-19)11-23-13-20-15-24(16-21(20)14-23)12-18-5-3-2-4-6-18/h2-10,17,20-21,25H,11-16H2,1H3/t17?,20-,21+ |
| InChIKey | ZWUOHUXVXXVEPV-PRJVBOEPSA-N |
| XLogP | 3.56 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |