C21H27NO3 — CID 145052357
4-[2-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol;phenol (PubChem CID 145052357) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-[2-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol;phenol.
| Compound Name | 4-[2-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol;phenol |
|---|---|
| PubChem CID | 145052357 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 4-[2-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol;phenol |
| SMILES | Oc1ccc(C(O)CN2C[C@H]3CCC[C@H]3C2)cc1.Oc1ccccc1 |
| InChI | InChI=1S/C15H21NO2.C6H6O/c17-14-6-4-11(5-7-14)15(18)10-16-8-12-2-1-3-13(12)9-16;7-6-4-2-1-3-5-6/h4-7,12-13,15,17-18H,1-3,8-10H2;1-5,7H/t12-,13+,15?; |
| InChIKey | SUBSQKRAFSEOAP-HLRVCSOFSA-N |
| XLogP | 3.55 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |