C22H25F2NO2 — CID 139667182
4-[2-[5-[(2,4-difluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol (PubChem CID 139667182) has the molecular formula C22H25F2NO2 and a molecular weight of 373.44 g/mol. Its IUPAC name is 4-[2-[5-[(2,4-difluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol.
| Compound Name | 4-[2-[5-[(2,4-difluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol |
|---|---|
| PubChem CID | 139667182 |
| Molecular Formula | C22H25F2NO2 |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 4-[2-[5-[(2,4-difluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]phenol |
| SMILES | Oc1ccc(C(O)CN2CC3CC(Cc4ccc(F)cc4F)CC3C2)cc1 |
| InChI | InChI=1S/C22H25F2NO2/c23-19-4-1-16(21(24)10-19)7-14-8-17-11-25(12-18(17)9-14)13-22(27)15-2-5-20(26)6-3-15/h1-6,10,14,17-18,22,26-27H,7-9,11-13H2 |
| InChIKey | KONMQLORYSLKDX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |