C14H21NO2 — CID 103936768
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1-phenylethanol (PubChem CID 103936768) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1-phenylethanol.
| Compound Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 103936768 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1-phenylethanol |
| SMILES | C[C@@H]1CN(CC(O)c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C14H21NO2/c1-11-8-15(9-12(2)17-11)10-14(16)13-6-4-3-5-7-13/h3-7,11-12,14,16H,8-10H2,1-2H3/t11-,12+,14? |
| InChIKey | SSOPCJHJRAAACK-ONXXMXGDSA-N |
| XLogP | 1.83 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |