C15H23N3O2 — CID 77043553
3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-2-phenylpropanimidamide (PubChem CID 77043553) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-2-phenylpropanimidamide.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 77043553 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-N'-hydroxy-2-phenylpropanimidamide |
| SMILES | CC1CN(CC(C(N)=NO)c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C15H23N3O2/c1-11-8-18(9-12(2)20-11)10-14(15(16)17-19)13-6-4-3-5-7-13/h3-7,11-12,14,19H,8-10H2,1-2H3,(H2,16,17) |
| InChIKey | LAKWMWDMCBCMJK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|